C28H41NO4 — CID 139717904
7-butoxy-1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxyquinolin-2-one (PubChem CID 139717904) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is 7-butoxy-1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxyquinolin-2-one.
| Compound Name | 7-butoxy-1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxyquinolin-2-one |
|---|---|
| PubChem CID | 139717904 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | 7-butoxy-1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxyquinolin-2-one |
| SMILES | CCCCOc1ccc2c(OC/C=C(\C)CCC=C(C)C)c(OC)c(=O)n(CCCC)c2c1 |
| InChI | InChI=1S/C28H41NO4/c1-7-9-17-29-25-20-23(32-18-10-8-2)14-15-24(25)26(27(31-6)28(29)30)33-19-16-22(5)13-11-12-21(3)4/h12,14-16,20H,7-11,13,17-19H2,1-6H3/b22-16+ |
| InChIKey | OLZVDOYCFCQELM-CJLVFECKSA-N |
| XLogP | 7.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|