C27H39NO4 — CID 139717384
7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3,4-dimethoxyquinolin-2-one (PubChem CID 139717384) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3,4-dimethoxyquinolin-2-one.
| Compound Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3,4-dimethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139717384 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3,4-dimethoxyquinolin-2-one |
| SMILES | CCCCCCn1c(=O)c(OC)c(OC)c2ccc(OC/C=C(\C)CCC=C(C)C)cc21 |
| InChI | InChI=1S/C27H39NO4/c1-7-8-9-10-17-28-24-19-22(32-18-16-21(4)13-11-12-20(2)3)14-15-23(24)25(30-5)26(31-6)27(28)29/h12,14-16,19H,7-11,13,17-18H2,1-6H3/b21-16+ |
| InChIKey | GAPYZWLAICZMBK-LTGZKZEYSA-N |
| XLogP | 6.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|