C35H52N2O3 — CID 54250246
7-amino-3,4-bis(3,7-dimethylocta-2,6-dienoxy)-1-hexylquinolin-2-one (PubChem CID 54250246) has the molecular formula C35H52N2O3 and a molecular weight of 548.81 g/mol. Its IUPAC name is 7-amino-3,4-bis(3,7-dimethylocta-2,6-dienoxy)-1-hexylquinolin-2-one.
| Compound Name | 7-amino-3,4-bis(3,7-dimethylocta-2,6-dienoxy)-1-hexylquinolin-2-one |
|---|---|
| PubChem CID | 54250246 |
| Molecular Formula | C35H52N2O3 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.40 |
| IUPAC Name | 7-amino-3,4-bis(3,7-dimethylocta-2,6-dienoxy)-1-hexylquinolin-2-one |
| SMILES | CCCCCCn1c(=O)c(OCC=C(C)CCC=C(C)C)c(OCC=C(C)CCC=C(C)C)c2ccc(N)cc21 |
| InChI | InChI=1S/C35H52N2O3/c1-8-9-10-11-22-37-32-25-30(36)18-19-31(32)33(39-23-20-28(6)16-12-14-26(2)3)34(35(37)38)40-24-21-29(7)17-13-15-27(4)5/h14-15,18-21,25H,8-13,16-17,22-24,36H2,1-7H3 |
| InChIKey | QWFZJCPGXJGTLN-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|