C24H34N2O4 — CID 23301111
[7-amino-4-(3-methylbut-2-enoxy)-1-octyl-2-oxoquinolin-3-yl] acetate (PubChem CID 23301111) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is [7-amino-4-(3-methylbut-2-enoxy)-1-octyl-2-oxoquinolin-3-yl] acetate.
| Compound Name | [7-amino-4-(3-methylbut-2-enoxy)-1-octyl-2-oxoquinolin-3-yl] acetate |
|---|---|
| PubChem CID | 23301111 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | [7-amino-4-(3-methylbut-2-enoxy)-1-octyl-2-oxoquinolin-3-yl] acetate |
| SMILES | CCCCCCCCn1c(=O)c(OC(C)=O)c(OCC=C(C)C)c2ccc(N)cc21 |
| InChI | InChI=1S/C24H34N2O4/c1-5-6-7-8-9-10-14-26-21-16-19(25)11-12-20(21)22(29-15-13-17(2)3)23(24(26)28)30-18(4)27/h11-13,16H,5-10,14-15,25H2,1-4H3 |
| InChIKey | KQMOOBDTAGERBL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|