C29H48N2O3 — CID 23300142
7-amino-3,4-dihexoxy-1-octylquinolin-2-one (PubChem CID 23300142) has the molecular formula C29H48N2O3 and a molecular weight of 472.71 g/mol. Its IUPAC name is 7-amino-3,4-dihexoxy-1-octylquinolin-2-one.
| Compound Name | 7-amino-3,4-dihexoxy-1-octylquinolin-2-one |
|---|---|
| PubChem CID | 23300142 |
| Molecular Formula | C29H48N2O3 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.37 |
| IUPAC Name | 7-amino-3,4-dihexoxy-1-octylquinolin-2-one |
| SMILES | CCCCCCCCn1c(=O)c(OCCCCCC)c(OCCCCCC)c2ccc(N)cc21 |
| InChI | InChI=1S/C29H48N2O3/c1-4-7-10-13-14-15-20-31-26-23-24(30)18-19-25(26)27(33-21-16-11-8-5-2)28(29(31)32)34-22-17-12-9-6-3/h18-19,23H,4-17,20-22,30H2,1-3H3 |
| InChIKey | QMCGQDXQXIPKJH-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|