C24H36N2O3 — CID 70248186
7-amino-3-butoxy-1-hexyl-4-pent-2-en-3-yloxyquinolin-2-one (PubChem CID 70248186) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is 7-amino-3-butoxy-1-hexyl-4-pent-2-en-3-yloxyquinolin-2-one.
| Compound Name | 7-amino-3-butoxy-1-hexyl-4-pent-2-en-3-yloxyquinolin-2-one |
|---|---|
| PubChem CID | 70248186 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | 7-amino-3-butoxy-1-hexyl-4-pent-2-en-3-yloxyquinolin-2-one |
| SMILES | CC=C(CC)Oc1c(OCCCC)c(=O)n(CCCCCC)c2cc(N)ccc12 |
| InChI | InChI=1S/C24H36N2O3/c1-5-9-11-12-15-26-21-17-18(25)13-14-20(21)22(29-19(7-3)8-4)23(24(26)27)28-16-10-6-2/h7,13-14,17H,5-6,8-12,15-16,25H2,1-4H3 |
| InChIKey | XGTJGVSQKWLZEZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|