C28H42N2O5 — CID 70251846
3-hexoxy-7-nitro-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one (PubChem CID 70251846) has the molecular formula C28H42N2O5 and a molecular weight of 486.65 g/mol. Its IUPAC name is 3-hexoxy-7-nitro-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one.
| Compound Name | 3-hexoxy-7-nitro-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one |
|---|---|
| PubChem CID | 70251846 |
| Molecular Formula | C28H42N2O5 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 3-hexoxy-7-nitro-1-octyl-4-pent-2-en-3-yloxyquinolin-2-one |
| SMILES | CC=C(CC)Oc1c(OCCCCCC)c(=O)n(CCCCCCCC)c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C28H42N2O5/c1-5-9-11-13-14-15-19-29-25-21-22(30(32)33)17-18-24(25)26(35-23(7-3)8-4)27(28(29)31)34-20-16-12-10-6-2/h7,17-18,21H,5-6,8-16,19-20H2,1-4H3 |
| InChIKey | XUUQDHLZJLGPLT-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|