C23H32N2O5 — CID 70251863
1-hexyl-7-nitro-4-pent-2-en-3-yloxy-3-propan-2-yloxyquinolin-2-one (PubChem CID 70251863) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is 1-hexyl-7-nitro-4-pent-2-en-3-yloxy-3-propan-2-yloxyquinolin-2-one.
| Compound Name | 1-hexyl-7-nitro-4-pent-2-en-3-yloxy-3-propan-2-yloxyquinolin-2-one |
|---|---|
| PubChem CID | 70251863 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-hexyl-7-nitro-4-pent-2-en-3-yloxy-3-propan-2-yloxyquinolin-2-one |
| SMILES | CC=C(CC)Oc1c(OC(C)C)c(=O)n(CCCCCC)c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C23H32N2O5/c1-6-9-10-11-14-24-20-15-17(25(27)28)12-13-19(20)21(30-18(7-2)8-3)22(23(24)26)29-16(4)5/h7,12-13,15-16H,6,8-11,14H2,1-5H3 |
| InChIKey | JWRMXSZYVJUBHT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|