C35H54N2O5 — CID 23300964
4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-nitro-3-octoxy-1-octylquinolin-2-one (PubChem CID 23300964) has the molecular formula C35H54N2O5 and a molecular weight of 582.83 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-nitro-3-octoxy-1-octylquinolin-2-one.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-nitro-3-octoxy-1-octylquinolin-2-one |
|---|---|
| PubChem CID | 23300964 |
| Molecular Formula | C35H54N2O5 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.40 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-nitro-3-octoxy-1-octylquinolin-2-one |
| SMILES | CCCCCCCCOc1c(OC/C=C(\C)CCC=C(C)C)c2ccc([N+](=O)[O-])cc2n(CCCCCCCC)c1=O |
| InChI | InChI=1S/C35H54N2O5/c1-6-8-10-12-14-16-24-36-32-27-30(37(39)40)21-22-31(32)33(42-26-23-29(5)20-18-19-28(3)4)34(35(36)38)41-25-17-15-13-11-9-7-2/h19,21-23,27H,6-18,20,24-26H2,1-5H3/b29-23+ |
| InChIKey | XQWIOWBWHGIYIE-BYNJWEBRSA-N |
| XLogP | 10.08 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|