C23H30N2O5 — CID 54713814
1-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-nitroquinolin-2-one (PubChem CID 54713814) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 1-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-nitroquinolin-2-one.
| Compound Name | 1-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-nitroquinolin-2-one |
|---|---|
| PubChem CID | 54713814 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-nitroquinolin-2-one |
| SMILES | CCCCn1c(=O)c(OC/C=C(\C)CCC=C(C)C)c(O)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C23H30N2O5/c1-5-6-13-24-20-15-18(25(28)29)10-11-19(20)21(26)22(23(24)27)30-14-12-17(4)9-7-8-16(2)3/h8,10-12,15,26H,5-7,9,13-14H2,1-4H3/b17-12+ |
| InChIKey | BLSVWTJRUIXUHA-SFQUDFHCSA-N |
| XLogP | 5.49 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|