C25H34N2O5 — CID 54291038
3-butoxy-4-(3,7-dimethylocta-2,6-dienoxy)-1-ethyl-7-nitroquinolin-2-one (PubChem CID 54291038) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-butoxy-4-(3,7-dimethylocta-2,6-dienoxy)-1-ethyl-7-nitroquinolin-2-one.
| Compound Name | 3-butoxy-4-(3,7-dimethylocta-2,6-dienoxy)-1-ethyl-7-nitroquinolin-2-one |
|---|---|
| PubChem CID | 54291038 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 3-butoxy-4-(3,7-dimethylocta-2,6-dienoxy)-1-ethyl-7-nitroquinolin-2-one |
| SMILES | CCCCOc1c(OCC=C(C)CCC=C(C)C)c2ccc([N+](=O)[O-])cc2n(CC)c1=O |
| InChI | InChI=1S/C25H34N2O5/c1-6-8-15-31-24-23(32-16-14-19(5)11-9-10-18(3)4)21-13-12-20(27(29)30)17-22(21)26(7-2)25(24)28/h10,12-14,17H,6-9,11,15-16H2,1-5H3 |
| InChIKey | RXNOBBSJPJTVMF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|