C27H38N2O5 — CID 54713836
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-nitro-1-octylquinolin-2-one (PubChem CID 54713836) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-nitro-1-octylquinolin-2-one.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-nitro-1-octylquinolin-2-one |
|---|---|
| PubChem CID | 54713836 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-7-nitro-1-octylquinolin-2-one |
| SMILES | CCCCCCCCn1c(=O)c(OC/C=C(\C)CCC=C(C)C)c(O)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C27H38N2O5/c1-5-6-7-8-9-10-17-28-24-19-22(29(32)33)14-15-23(24)25(30)26(27(28)31)34-18-16-21(4)13-11-12-20(2)3/h12,14-16,19,30H,5-11,13,17-18H2,1-4H3/b21-16+ |
| InChIKey | ZPEFOURXZREBGS-LTGZKZEYSA-N |
| XLogP | 7.05 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|