C25H36N2O3 — CID 23300129
7-amino-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3-hydroxyquinolin-2-one (PubChem CID 23300129) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 7-amino-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3-hydroxyquinolin-2-one.
| Compound Name | 7-amino-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3-hydroxyquinolin-2-one |
|---|---|
| PubChem CID | 23300129 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 7-amino-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-3-hydroxyquinolin-2-one |
| SMILES | CCCCCCn1c(=O)c(O)c(OC/C=C(\C)CCC=C(C)C)c2ccc(N)cc21 |
| InChI | InChI=1S/C25H36N2O3/c1-5-6-7-8-15-27-22-17-20(26)12-13-21(22)24(23(28)25(27)29)30-16-14-19(4)11-9-10-18(2)3/h10,12-14,17,28H,5-9,11,15-16,26H2,1-4H3/b19-14+ |
| InChIKey | RZLJHDZLOAWRDY-XMHGGMMESA-N |
| XLogP | 5.94 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|