C30H37NO4 — CID 139718552
1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxy-7-phenylmethoxyquinolin-2-one (PubChem CID 139718552) has the molecular formula C30H37NO4 and a molecular weight of 475.63 g/mol. Its IUPAC name is 1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxy-7-phenylmethoxyquinolin-2-one.
| Compound Name | 1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxy-7-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718552 |
| Molecular Formula | C30H37NO4 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxy-7-phenylmethoxyquinolin-2-one |
| SMILES | CCCCn1c(=O)c(O)c(OC/C=C(\C)CCC=C(C)C)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C30H37NO4/c1-5-6-18-31-27-20-25(35-21-24-13-8-7-9-14-24)15-16-26(27)29(28(32)30(31)33)34-19-17-23(4)12-10-11-22(2)3/h7-9,11,13-17,20,32H,5-6,10,12,18-19,21H2,1-4H3/b23-17+ |
| InChIKey | WKSKGMFSICKKBH-HAVVHWLPSA-N |
| XLogP | 7.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|