C27H39NO4 — CID 139718091
7-butoxy-1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxyquinolin-2-one (PubChem CID 139718091) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is 7-butoxy-1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxyquinolin-2-one.
| Compound Name | 7-butoxy-1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxyquinolin-2-one |
|---|---|
| PubChem CID | 139718091 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 7-butoxy-1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxyquinolin-2-one |
| SMILES | CCCCOc1ccc2c(OC/C=C(\C)CCC=C(C)C)c(O)c(=O)n(CCCC)c2c1 |
| InChI | InChI=1S/C27H39NO4/c1-6-8-16-28-24-19-22(31-17-9-7-2)13-14-23(24)26(25(29)27(28)30)32-18-15-21(5)12-10-11-20(3)4/h11,13-15,19,29H,6-10,12,16-18H2,1-5H3/b21-15+ |
| InChIKey | GJJQNDPCDKGCKQ-RCCKNPSSSA-N |
| XLogP | 6.76 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|