C22H31NO4 — CID 139716929
7-butoxy-1-butyl-4-hydroxy-3-(3-methylbut-2-enoxy)quinolin-2-one (PubChem CID 139716929) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is 7-butoxy-1-butyl-4-hydroxy-3-(3-methylbut-2-enoxy)quinolin-2-one.
| Compound Name | 7-butoxy-1-butyl-4-hydroxy-3-(3-methylbut-2-enoxy)quinolin-2-one |
|---|---|
| PubChem CID | 139716929 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 7-butoxy-1-butyl-4-hydroxy-3-(3-methylbut-2-enoxy)quinolin-2-one |
| SMILES | CCCCOc1ccc2c(O)c(OCC=C(C)C)c(=O)n(CCCC)c2c1 |
| InChI | InChI=1S/C22H31NO4/c1-5-7-12-23-19-15-17(26-13-8-6-2)9-10-18(19)20(24)21(22(23)25)27-14-11-16(3)4/h9-11,15,24H,5-8,12-14H2,1-4H3 |
| InChIKey | TUTCMLHWKJNAON-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|