C24H29NO4 — CID 139717487
7-butoxy-1-butyl-4-hydroxy-3-phenylmethoxyquinolin-2-one (PubChem CID 139717487) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 7-butoxy-1-butyl-4-hydroxy-3-phenylmethoxyquinolin-2-one.
| Compound Name | 7-butoxy-1-butyl-4-hydroxy-3-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139717487 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 7-butoxy-1-butyl-4-hydroxy-3-phenylmethoxyquinolin-2-one |
| SMILES | CCCCOc1ccc2c(O)c(OCc3ccccc3)c(=O)n(CCCC)c2c1 |
| InChI | InChI=1S/C24H29NO4/c1-3-5-14-25-21-16-19(28-15-6-4-2)12-13-20(21)22(26)23(24(25)27)29-17-18-10-8-7-9-11-18/h7-13,16,26H,3-6,14-15,17H2,1-2H3 |
| InChIKey | DBZUHLYYTSZQKU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|