C27H27NO4 — CID 139717687
1-butyl-7-hydroxy-3,4-bis(phenylmethoxy)quinolin-2-one (PubChem CID 139717687) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-butyl-7-hydroxy-3,4-bis(phenylmethoxy)quinolin-2-one.
| Compound Name | 1-butyl-7-hydroxy-3,4-bis(phenylmethoxy)quinolin-2-one |
|---|---|
| PubChem CID | 139717687 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-butyl-7-hydroxy-3,4-bis(phenylmethoxy)quinolin-2-one |
| SMILES | CCCCn1c(=O)c(OCc2ccccc2)c(OCc2ccccc2)c2ccc(O)cc21 |
| InChI | InChI=1S/C27H27NO4/c1-2-3-16-28-24-17-22(29)14-15-23(24)25(31-18-20-10-6-4-7-11-20)26(27(28)30)32-19-21-12-8-5-9-13-21/h4-15,17,29H,2-3,16,18-19H2,1H3 |
| InChIKey | VXCBCBSWMDHOOX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |