C25H31NO4 — CID 139717520
4-hexoxy-7-hydroxy-3-phenylmethoxy-1-propan-2-ylquinolin-2-one (PubChem CID 139717520) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-hexoxy-7-hydroxy-3-phenylmethoxy-1-propan-2-ylquinolin-2-one.
| Compound Name | 4-hexoxy-7-hydroxy-3-phenylmethoxy-1-propan-2-ylquinolin-2-one |
|---|---|
| PubChem CID | 139717520 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 4-hexoxy-7-hydroxy-3-phenylmethoxy-1-propan-2-ylquinolin-2-one |
| SMILES | CCCCCCOc1c(OCc2ccccc2)c(=O)n(C(C)C)c2cc(O)ccc12 |
| InChI | InChI=1S/C25H31NO4/c1-4-5-6-10-15-29-23-21-14-13-20(27)16-22(21)26(18(2)3)25(28)24(23)30-17-19-11-8-7-9-12-19/h7-9,11-14,16,18,27H,4-6,10,15,17H2,1-3H3 |
| InChIKey | WDNRJQRDLLLVKL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|