C29H39NO4 — CID 139718339
4-butoxy-1-methyl-3-octoxy-7-phenylmethoxyquinolin-2-one (PubChem CID 139718339) has the molecular formula C29H39NO4 and a molecular weight of 465.63 g/mol. Its IUPAC name is 4-butoxy-1-methyl-3-octoxy-7-phenylmethoxyquinolin-2-one.
| Compound Name | 4-butoxy-1-methyl-3-octoxy-7-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718339 |
| Molecular Formula | C29H39NO4 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | 4-butoxy-1-methyl-3-octoxy-7-phenylmethoxyquinolin-2-one |
| SMILES | CCCCCCCCOc1c(OCCCC)c2ccc(OCc3ccccc3)cc2n(C)c1=O |
| InChI | InChI=1S/C29H39NO4/c1-4-6-8-9-10-14-20-33-28-27(32-19-7-5-2)25-18-17-24(21-26(25)30(3)29(28)31)34-22-23-15-12-11-13-16-23/h11-13,15-18,21H,4-10,14,19-20,22H2,1-3H3 |
| InChIKey | DPEMSQXNSOHHHS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|