C27H35NO4 — CID 139717303
4-butoxy-1-hexyl-3-methoxy-7-phenylmethoxyquinolin-2-one (PubChem CID 139717303) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is 4-butoxy-1-hexyl-3-methoxy-7-phenylmethoxyquinolin-2-one.
| Compound Name | 4-butoxy-1-hexyl-3-methoxy-7-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139717303 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 4-butoxy-1-hexyl-3-methoxy-7-phenylmethoxyquinolin-2-one |
| SMILES | CCCCCCn1c(=O)c(OC)c(OCCCC)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C27H35NO4/c1-4-6-8-12-17-28-24-19-22(32-20-21-13-10-9-11-14-21)15-16-23(24)25(31-18-7-5-2)26(30-3)27(28)29/h9-11,13-16,19H,4-8,12,17-18,20H2,1-3H3 |
| InChIKey | UMOBZLKHCYSFES-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|