C28H37NO4 — CID 139718046
3-butoxy-7-hydroxy-1-octyl-4-phenylmethoxyquinolin-2-one (PubChem CID 139718046) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is 3-butoxy-7-hydroxy-1-octyl-4-phenylmethoxyquinolin-2-one.
| Compound Name | 3-butoxy-7-hydroxy-1-octyl-4-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718046 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 3-butoxy-7-hydroxy-1-octyl-4-phenylmethoxyquinolin-2-one |
| SMILES | CCCCCCCCn1c(=O)c(OCCCC)c(OCc2ccccc2)c2ccc(O)cc21 |
| InChI | InChI=1S/C28H37NO4/c1-3-5-7-8-9-13-18-29-25-20-23(30)16-17-24(25)26(27(28(29)31)32-19-6-4-2)33-21-22-14-11-10-12-15-22/h10-12,14-17,20,30H,3-9,13,18-19,21H2,1-2H3 |
| InChIKey | RHQDARUOYIDXAN-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|