C26H33NO4 — CID 139717726
7-butoxy-1-hexyl-4-hydroxy-3-phenylmethoxyquinolin-2-one (PubChem CID 139717726) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 7-butoxy-1-hexyl-4-hydroxy-3-phenylmethoxyquinolin-2-one.
| Compound Name | 7-butoxy-1-hexyl-4-hydroxy-3-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139717726 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 7-butoxy-1-hexyl-4-hydroxy-3-phenylmethoxyquinolin-2-one |
| SMILES | CCCCCCn1c(=O)c(OCc2ccccc2)c(O)c2ccc(OCCCC)cc21 |
| InChI | InChI=1S/C26H33NO4/c1-3-5-7-11-16-27-23-18-21(30-17-6-4-2)14-15-22(23)24(28)25(26(27)29)31-19-20-12-9-8-10-13-20/h8-10,12-15,18,28H,3-7,11,16-17,19H2,1-2H3 |
| InChIKey | MNIUELMGXXTBMM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|