C33H39NO4 — CID 139718064
1-butyl-4-hexoxy-3,7-bis(phenylmethoxy)quinolin-2-one (PubChem CID 139718064) has the molecular formula C33H39NO4 and a molecular weight of 513.68 g/mol. Its IUPAC name is 1-butyl-4-hexoxy-3,7-bis(phenylmethoxy)quinolin-2-one.
| Compound Name | 1-butyl-4-hexoxy-3,7-bis(phenylmethoxy)quinolin-2-one |
|---|---|
| PubChem CID | 139718064 |
| Molecular Formula | C33H39NO4 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | 1-butyl-4-hexoxy-3,7-bis(phenylmethoxy)quinolin-2-one |
| SMILES | CCCCCCOc1c(OCc2ccccc2)c(=O)n(CCCC)c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C33H39NO4/c1-3-5-7-14-22-36-31-29-20-19-28(37-24-26-15-10-8-11-16-26)23-30(29)34(21-6-4-2)33(35)32(31)38-25-27-17-12-9-13-18-27/h8-13,15-20,23H,3-7,14,21-22,24-25H2,1-2H3 |
| InChIKey | JILJNNZABVKUQQ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|