C28H29NO4 — CID 139717135
4-butoxy-1-methyl-3,7-bis(phenylmethoxy)quinolin-2-one (PubChem CID 139717135) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-butoxy-1-methyl-3,7-bis(phenylmethoxy)quinolin-2-one.
| Compound Name | 4-butoxy-1-methyl-3,7-bis(phenylmethoxy)quinolin-2-one |
|---|---|
| PubChem CID | 139717135 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 4-butoxy-1-methyl-3,7-bis(phenylmethoxy)quinolin-2-one |
| SMILES | CCCCOc1c(OCc2ccccc2)c(=O)n(C)c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C28H29NO4/c1-3-4-17-31-26-24-16-15-23(32-19-21-11-7-5-8-12-21)18-25(24)29(2)28(30)27(26)33-20-22-13-9-6-10-14-22/h5-16,18H,3-4,17,19-20H2,1-2H3 |
| InChIKey | MIXSHQSQSNICJS-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|