C25H23NO4 — CID 139718000
3-methoxy-1-methyl-4,7-bis(phenylmethoxy)quinolin-2-one (PubChem CID 139718000) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-methoxy-1-methyl-4,7-bis(phenylmethoxy)quinolin-2-one.
| Compound Name | 3-methoxy-1-methyl-4,7-bis(phenylmethoxy)quinolin-2-one |
|---|---|
| PubChem CID | 139718000 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 3-methoxy-1-methyl-4,7-bis(phenylmethoxy)quinolin-2-one |
| SMILES | COc1c(OCc2ccccc2)c2ccc(OCc3ccccc3)cc2n(C)c1=O |
| InChI | InChI=1S/C25H23NO4/c1-26-22-15-20(29-16-18-9-5-3-6-10-18)13-14-21(22)23(24(28-2)25(26)27)30-17-19-11-7-4-8-12-19/h3-15H,16-17H2,1-2H3 |
| InChIKey | PQSXVAZSDJWTNL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |