C22H23NO4 — CID 139716931
4-hydroxy-1-methyl-3-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one (PubChem CID 139716931) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-3-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one.
| Compound Name | 4-hydroxy-1-methyl-3-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139716931 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-hydroxy-1-methyl-3-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one |
| SMILES | CC(C)=CCOc1c(O)c2ccc(OCc3ccccc3)cc2n(C)c1=O |
| InChI | InChI=1S/C22H23NO4/c1-15(2)11-12-26-21-20(24)18-10-9-17(13-19(18)23(3)22(21)25)27-14-16-7-5-4-6-8-16/h4-11,13,24H,12,14H2,1-3H3 |
| InChIKey | CFJXCVDYNDOWGX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|