C24H33NO4 — CID 139717292
3-butoxy-7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-1-methylquinolin-2-one (PubChem CID 139717292) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is 3-butoxy-7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-1-methylquinolin-2-one.
| Compound Name | 3-butoxy-7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 139717292 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 3-butoxy-7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-1-methylquinolin-2-one |
| SMILES | CCCCOc1c(O)c2ccc(OC/C=C(\C)CCC=C(C)C)cc2n(C)c1=O |
| InChI | InChI=1S/C24H33NO4/c1-6-7-14-29-23-22(26)20-12-11-19(16-21(20)25(5)24(23)27)28-15-13-18(4)10-8-9-17(2)3/h9,11-13,16,26H,6-8,10,14-15H2,1-5H3/b18-13+ |
| InChIKey | HOROQSJZYUFJJF-QGOAFFKASA-N |
| XLogP | 5.49 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|