C29H43NO4 — CID 139717813
4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-methoxy-1-methyl-3-octoxyquinolin-2-one (PubChem CID 139717813) has the molecular formula C29H43NO4 and a molecular weight of 469.67 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-methoxy-1-methyl-3-octoxyquinolin-2-one.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-methoxy-1-methyl-3-octoxyquinolin-2-one |
|---|---|
| PubChem CID | 139717813 |
| Molecular Formula | C29H43NO4 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-methoxy-1-methyl-3-octoxyquinolin-2-one |
| SMILES | CCCCCCCCOc1c(OC/C=C(\C)CCC=C(C)C)c2ccc(OC)cc2n(C)c1=O |
| InChI | InChI=1S/C29H43NO4/c1-7-8-9-10-11-12-19-33-28-27(34-20-18-23(4)15-13-14-22(2)3)25-17-16-24(32-6)21-26(25)30(5)29(28)31/h14,16-18,21H,7-13,15,19-20H2,1-6H3/b23-18+ |
| InChIKey | UJDQVTQGVJCRRF-PTGBLXJZSA-N |
| XLogP | 7.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|