C33H50N2O3 — CID 54152349
3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-4-(3-methylbut-2-enoxy)-7-(octylamino)quinolin-2-one (PubChem CID 54152349) has the molecular formula C33H50N2O3 and a molecular weight of 522.77 g/mol. Its IUPAC name is 3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-4-(3-methylbut-2-enoxy)-7-(octylamino)quinolin-2-one.
| Compound Name | 3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-4-(3-methylbut-2-enoxy)-7-(octylamino)quinolin-2-one |
|---|---|
| PubChem CID | 54152349 |
| Molecular Formula | C33H50N2O3 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.38 |
| IUPAC Name | 3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-4-(3-methylbut-2-enoxy)-7-(octylamino)quinolin-2-one |
| SMILES | CCCCCCCCNc1ccc2c(OCC=C(C)C)c(OCC=C(C)CCC=C(C)C)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C33H50N2O3/c1-8-9-10-11-12-13-21-34-28-17-18-29-30(24-28)35(7)33(36)32(31(29)37-22-19-26(4)5)38-23-20-27(6)16-14-15-25(2)3/h15,17-20,24,34H,8-14,16,21-23H2,1-7H3 |
| InChIKey | OIPOKNQAXKAJLT-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|