C33H52N2O3 — CID 23301254
4-butoxy-1-butyl-7-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-3-hexoxyquinolin-2-one (PubChem CID 23301254) has the molecular formula C33H52N2O3 and a molecular weight of 524.79 g/mol. Its IUPAC name is 4-butoxy-1-butyl-7-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-3-hexoxyquinolin-2-one.
| Compound Name | 4-butoxy-1-butyl-7-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-3-hexoxyquinolin-2-one |
|---|---|
| PubChem CID | 23301254 |
| Molecular Formula | C33H52N2O3 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | 4-butoxy-1-butyl-7-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-3-hexoxyquinolin-2-one |
| SMILES | CCCCCCOc1c(OCCCC)c2ccc(NC/C=C(\C)CCC=C(C)C)cc2n(CCCC)c1=O |
| InChI | InChI=1S/C33H52N2O3/c1-7-10-13-14-24-38-32-31(37-23-12-9-3)29-19-18-28(25-30(29)35(33(32)36)22-11-8-2)34-21-20-27(6)17-15-16-26(4)5/h16,18-20,25,34H,7-15,17,21-24H2,1-6H3/b27-20+ |
| InChIKey | HLZRKYWBSXVBPH-NHFJDJAPSA-N |
| XLogP | 9.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|