C40H54N2O4 — CID 70251869
N-[3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hexoxy-1-hexyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide (PubChem CID 70251869) has the molecular formula C40H54N2O4 and a molecular weight of 626.88 g/mol. Its IUPAC name is N-[3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hexoxy-1-hexyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hexoxy-1-hexyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 70251869 |
| Molecular Formula | C40H54N2O4 |
| Molecular Weight | 626.88 g/mol |
| Exact Mass | 626.41 |
| IUPAC Name | N-[3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hexoxy-1-hexyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide |
| SMILES | CCCCCCOc1c(OC/C=C(\C)CCC=C(C)C)c(=O)n(CCCCCC)c2cc(NC(=O)C=Cc3ccccc3)ccc12 |
| InChI | InChI=1S/C40H54N2O4/c1-6-8-10-15-27-42-36-30-34(41-37(43)25-22-33-20-13-12-14-21-33)23-24-35(36)38(45-28-16-11-9-7-2)39(40(42)44)46-29-26-32(5)19-17-18-31(3)4/h12-14,18,20-26,30H,6-11,15-17,19,27-29H2,1-5H3,(H,41,43)/b25-22?,32-26+ |
| InChIKey | AFCCFDGRVKENAJ-WXFNJOELSA-N |
| XLogP | 10.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.88 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|