C34H44N2O5 — CID 23301167
[4-hexoxy-1-octyl-2-oxo-7-[[(E)-3-phenylprop-2-enoyl]amino]quinolin-3-yl] acetate (PubChem CID 23301167) has the molecular formula C34H44N2O5 and a molecular weight of 560.74 g/mol. Its IUPAC name is [4-hexoxy-1-octyl-2-oxo-7-[[(E)-3-phenylprop-2-enoyl]amino]quinolin-3-yl] acetate.
| Compound Name | [4-hexoxy-1-octyl-2-oxo-7-[[(E)-3-phenylprop-2-enoyl]amino]quinolin-3-yl] acetate |
|---|---|
| PubChem CID | 23301167 |
| Molecular Formula | C34H44N2O5 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | [4-hexoxy-1-octyl-2-oxo-7-[[(E)-3-phenylprop-2-enoyl]amino]quinolin-3-yl] acetate |
| SMILES | CCCCCCCCn1c(=O)c(OC(C)=O)c(OCCCCCC)c2ccc(NC(=O)/C=C/c3ccccc3)cc21 |
| InChI | InChI=1S/C34H44N2O5/c1-4-6-8-10-11-15-23-36-30-25-28(35-31(38)22-19-27-17-13-12-14-18-27)20-21-29(30)32(40-24-16-9-7-5-2)33(34(36)39)41-26(3)37/h12-14,17-22,25H,4-11,15-16,23-24H2,1-3H3,(H,35,38)/b22-19+ |
| InChIKey | HATHNQBOUSAFES-ZBJSNUHESA-N |
| XLogP | 7.90 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|