C31H38N2O7 — CID 21217791
(E)-N-[1-hexyl-3-hydroxy-4-(3-methylbut-2-enoxy)-2-oxoquinolin-7-yl]-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 21217791) has the molecular formula C31H38N2O7 and a molecular weight of 550.65 g/mol. Its IUPAC name is (E)-N-[1-hexyl-3-hydroxy-4-(3-methylbut-2-enoxy)-2-oxoquinolin-7-yl]-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-hexyl-3-hydroxy-4-(3-methylbut-2-enoxy)-2-oxoquinolin-7-yl]-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 21217791 |
| Molecular Formula | C31H38N2O7 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | (E)-N-[1-hexyl-3-hydroxy-4-(3-methylbut-2-enoxy)-2-oxoquinolin-7-yl]-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCn1c(=O)c(O)c(OCC=C(C)C)c2ccc(NC(=O)/C=C/c3cc(OC)c(O)c(OC)c3)cc21 |
| InChI | InChI=1S/C31H38N2O7/c1-6-7-8-9-15-33-24-19-22(11-12-23(24)30(29(36)31(33)37)40-16-14-20(2)3)32-27(34)13-10-21-17-25(38-4)28(35)26(18-21)39-5/h10-14,17-19,35-36H,6-9,15-16H2,1-5H3,(H,32,34)/b13-10+ |
| InChIKey | NTNFKGHIUWVWEW-JLHYYAGUSA-N |
| XLogP | 6.01 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|