C29H36N2O7 — CID 67309500
3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(4-hydroxy-1-methyl-8-octoxy-2-oxoquinolin-7-yl)prop-2-enamide (PubChem CID 67309500) has the molecular formula C29H36N2O7 and a molecular weight of 524.61 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(4-hydroxy-1-methyl-8-octoxy-2-oxoquinolin-7-yl)prop-2-enamide.
| Compound Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(4-hydroxy-1-methyl-8-octoxy-2-oxoquinolin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 67309500 |
| Molecular Formula | C29H36N2O7 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(4-hydroxy-1-methyl-8-octoxy-2-oxoquinolin-7-yl)prop-2-enamide |
| SMILES | CCCCCCCCOc1c(NC(=O)C=Cc2cc(OC)c(O)c(OC)c2)ccc2c(O)cc(=O)n(C)c12 |
| InChI | InChI=1S/C29H36N2O7/c1-5-6-7-8-9-10-15-38-29-21(13-12-20-22(32)18-26(34)31(2)27(20)29)30-25(33)14-11-19-16-23(36-3)28(35)24(17-19)37-4/h11-14,16-18,32,35H,5-10,15H2,1-4H3,(H,30,33) |
| InChIKey | KMVVTMTWTIQIFG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|