C28H38N2O6 — CID 140995406
3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[3-[methyl-(2-octoxyacetyl)amino]phenyl]prop-2-enamide (PubChem CID 140995406) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[3-[methyl-(2-octoxyacetyl)amino]phenyl]prop-2-enamide.
| Compound Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[3-[methyl-(2-octoxyacetyl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 140995406 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[3-[methyl-(2-octoxyacetyl)amino]phenyl]prop-2-enamide |
| SMILES | CCCCCCCCOCC(=O)N(C)c1cccc(NC(=O)C=Cc2cc(OC)c(O)c(OC)c2)c1 |
| InChI | InChI=1S/C28H38N2O6/c1-5-6-7-8-9-10-16-36-20-27(32)30(2)23-13-11-12-22(19-23)29-26(31)15-14-21-17-24(34-3)28(33)25(18-21)35-4/h11-15,17-19,33H,5-10,16,20H2,1-4H3,(H,29,31) |
| InChIKey | IXDBBDQQXTYOGK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|