C35H44N2O4 — CID 54572786
N-[3-(3,7-dimethylocta-2,6-dienoxy)-4-hexoxy-1-methyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide (PubChem CID 54572786) has the molecular formula C35H44N2O4 and a molecular weight of 556.75 g/mol. Its IUPAC name is N-[3-(3,7-dimethylocta-2,6-dienoxy)-4-hexoxy-1-methyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[3-(3,7-dimethylocta-2,6-dienoxy)-4-hexoxy-1-methyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 54572786 |
| Molecular Formula | C35H44N2O4 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | N-[3-(3,7-dimethylocta-2,6-dienoxy)-4-hexoxy-1-methyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide |
| SMILES | CCCCCCOc1c(OCC=C(C)CCC=C(C)C)c(=O)n(C)c2cc(NC(=O)C=Cc3ccccc3)ccc12 |
| InChI | InChI=1S/C35H44N2O4/c1-6-7-8-12-23-40-33-30-20-19-29(36-32(38)21-18-28-16-10-9-11-17-28)25-31(30)37(5)35(39)34(33)41-24-22-27(4)15-13-14-26(2)3/h9-11,14,16-22,25H,6-8,12-13,15,23-24H2,1-5H3,(H,36,38) |
| InChIKey | ZYMNBBVDKXKKPY-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|