C38H50N2O4 — CID 23300470
(E)-N-[4-butoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide (PubChem CID 23300470) has the molecular formula C38H50N2O4 and a molecular weight of 598.83 g/mol. Its IUPAC name is (E)-N-[4-butoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-butoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 23300470 |
| Molecular Formula | C38H50N2O4 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.38 |
| IUPAC Name | (E)-N-[4-butoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-2-oxoquinolin-7-yl]-3-phenylprop-2-enamide |
| SMILES | CCCCCCn1c(=O)c(OC/C=C(\C)CCC=C(C)C)c(OCCCC)c2ccc(NC(=O)/C=C/c3ccccc3)cc21 |
| InChI | InChI=1S/C38H50N2O4/c1-6-8-10-14-25-40-34-28-32(39-35(41)23-20-31-18-12-11-13-19-31)21-22-33(34)36(43-26-9-7-2)37(38(40)42)44-27-24-30(5)17-15-16-29(3)4/h11-13,16,18-24,28H,6-10,14-15,17,25-27H2,1-5H3,(H,39,41)/b23-20+,30-24+ |
| InChIKey | OOEBYWUUHLAHHA-ZHPQQGFUSA-N |
| XLogP | 9.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|