C28H38N2O4 — CID 23301166
N-[1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxo-3-prop-2-enoxyquinolin-7-yl]acetamide (PubChem CID 23301166) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is N-[1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxo-3-prop-2-enoxyquinolin-7-yl]acetamide.
| Compound Name | N-[1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxo-3-prop-2-enoxyquinolin-7-yl]acetamide |
|---|---|
| PubChem CID | 23301166 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | N-[1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxo-3-prop-2-enoxyquinolin-7-yl]acetamide |
| SMILES | C=CCOc1c(OC/C=C(\C)CCC=C(C)C)c2ccc(NC(C)=O)cc2n(CCCC)c1=O |
| InChI | InChI=1S/C28H38N2O4/c1-7-9-16-30-25-19-23(29-22(6)31)13-14-24(25)26(27(28(30)32)33-17-8-2)34-18-15-21(5)12-10-11-20(3)4/h8,11,13-15,19H,2,7,9-10,12,16-18H2,1,3-6H3,(H,29,31)/b21-15+ |
| InChIKey | URICWRTULLQSLN-RCCKNPSSSA-N |
| XLogP | 6.40 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|