C30H43NO4 — CID 139718328
4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-hydroxy-1-octyl-3-prop-2-enoxyquinolin-2-one (PubChem CID 139718328) has the molecular formula C30H43NO4 and a molecular weight of 481.68 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-hydroxy-1-octyl-3-prop-2-enoxyquinolin-2-one.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-hydroxy-1-octyl-3-prop-2-enoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718328 |
| Molecular Formula | C30H43NO4 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-hydroxy-1-octyl-3-prop-2-enoxyquinolin-2-one |
| SMILES | C=CCOc1c(OC/C=C(\C)CCC=C(C)C)c2ccc(O)cc2n(CCCCCCCC)c1=O |
| InChI | InChI=1S/C30H43NO4/c1-6-8-9-10-11-12-19-31-27-22-25(32)16-17-26(27)28(29(30(31)33)34-20-7-2)35-21-18-24(5)15-13-14-23(3)4/h7,14,16-18,22,32H,2,6,8-13,15,19-21H2,1,3-5H3/b24-18+ |
| InChIKey | RNJXNZNVMBDXSI-HKOYGPOVSA-N |
| XLogP | 7.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|