C38H53NO4 — CID 139718562
7-butoxy-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-octyl-3-phenylmethoxyquinolin-2-one (PubChem CID 139718562) has the molecular formula C38H53NO4 and a molecular weight of 587.85 g/mol. Its IUPAC name is 7-butoxy-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-octyl-3-phenylmethoxyquinolin-2-one.
| Compound Name | 7-butoxy-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-octyl-3-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718562 |
| Molecular Formula | C38H53NO4 |
| Molecular Weight | 587.85 g/mol |
| Exact Mass | 587.40 |
| IUPAC Name | 7-butoxy-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-octyl-3-phenylmethoxyquinolin-2-one |
| SMILES | CCCCCCCCn1c(=O)c(OCc2ccccc2)c(OC/C=C(\C)CCC=C(C)C)c2ccc(OCCCC)cc21 |
| InChI | InChI=1S/C38H53NO4/c1-6-8-10-11-12-16-25-39-35-28-33(41-26-9-7-2)22-23-34(35)36(42-27-24-31(5)19-17-18-30(3)4)37(38(39)40)43-29-32-20-14-13-15-21-32/h13-15,18,20-24,28H,6-12,16-17,19,25-27,29H2,1-5H3/b31-24+ |
| InChIKey | HSJAFAROZSHWBS-QFMPWRQOSA-N |
| XLogP | 10.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.85 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|