C39H54N2O3 — CID 54275076
7-(benzylamino)-3-(3,7-dimethylocta-2,6-dienoxy)-4-(3-methylbut-2-enoxy)-1-octylquinolin-2-one (PubChem CID 54275076) has the molecular formula C39H54N2O3 and a molecular weight of 598.87 g/mol. Its IUPAC name is 7-(benzylamino)-3-(3,7-dimethylocta-2,6-dienoxy)-4-(3-methylbut-2-enoxy)-1-octylquinolin-2-one.
| Compound Name | 7-(benzylamino)-3-(3,7-dimethylocta-2,6-dienoxy)-4-(3-methylbut-2-enoxy)-1-octylquinolin-2-one |
|---|---|
| PubChem CID | 54275076 |
| Molecular Formula | C39H54N2O3 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.41 |
| IUPAC Name | 7-(benzylamino)-3-(3,7-dimethylocta-2,6-dienoxy)-4-(3-methylbut-2-enoxy)-1-octylquinolin-2-one |
| SMILES | CCCCCCCCn1c(=O)c(OCC=C(C)CCC=C(C)C)c(OCC=C(C)C)c2ccc(NCc3ccccc3)cc21 |
| InChI | InChI=1S/C39H54N2O3/c1-7-8-9-10-11-15-25-41-36-28-34(40-29-33-19-13-12-14-20-33)21-22-35(36)37(43-26-23-31(4)5)38(39(41)42)44-27-24-32(6)18-16-17-30(2)3/h12-14,17,19-24,28,40H,7-11,15-16,18,25-27,29H2,1-6H3 |
| InChIKey | RMVVMNPTICVRLP-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|