C39H60N2O3 — CID 23300272
1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-3-hexoxyquinolin-2-one (PubChem CID 23300272) has the molecular formula C39H60N2O3 and a molecular weight of 604.92 g/mol. Its IUPAC name is 1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-3-hexoxyquinolin-2-one.
| Compound Name | 1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-3-hexoxyquinolin-2-one |
|---|---|
| PubChem CID | 23300272 |
| Molecular Formula | C39H60N2O3 |
| Molecular Weight | 604.92 g/mol |
| Exact Mass | 604.46 |
| IUPAC Name | 1-butyl-4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-3-hexoxyquinolin-2-one |
| SMILES | CCCCCCOc1c(OC/C=C(\C)CCC=C(C)C)c2ccc(NC/C=C(\C)CCC=C(C)C)cc2n(CCCC)c1=O |
| InChI | InChI=1S/C39H60N2O3/c1-9-11-13-14-27-43-38-37(44-28-24-33(8)20-16-18-31(5)6)35-22-21-34(29-36(35)41(39(38)42)26-12-10-2)40-25-23-32(7)19-15-17-30(3)4/h17-18,21-24,29,40H,9-16,19-20,25-28H2,1-8H3/b32-23+,33-24+ |
| InChIKey | GEQMUCKZFSERIW-GRSDYBEUSA-N |
| XLogP | 10.94 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.92 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|