C29H42N2O3 — CID 54151570
1-butyl-4-(3,7-dimethylocta-2,6-dienoxy)-3-propan-2-yloxy-7-(prop-2-enylamino)quinolin-2-one (PubChem CID 54151570) has the molecular formula C29H42N2O3 and a molecular weight of 466.67 g/mol. Its IUPAC name is 1-butyl-4-(3,7-dimethylocta-2,6-dienoxy)-3-propan-2-yloxy-7-(prop-2-enylamino)quinolin-2-one.
| Compound Name | 1-butyl-4-(3,7-dimethylocta-2,6-dienoxy)-3-propan-2-yloxy-7-(prop-2-enylamino)quinolin-2-one |
|---|---|
| PubChem CID | 54151570 |
| Molecular Formula | C29H42N2O3 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | 1-butyl-4-(3,7-dimethylocta-2,6-dienoxy)-3-propan-2-yloxy-7-(prop-2-enylamino)quinolin-2-one |
| SMILES | C=CCNc1ccc2c(OCC=C(C)CCC=C(C)C)c(OC(C)C)c(=O)n(CCCC)c2c1 |
| InChI | InChI=1S/C29H42N2O3/c1-8-10-18-31-26-20-24(30-17-9-2)14-15-25(26)27(28(29(31)32)34-22(5)6)33-19-16-23(7)13-11-12-21(3)4/h9,12,14-16,20,22,30H,2,8,10-11,13,17-19H2,1,3-7H3 |
| InChIKey | OICIRQJKWSHIOZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|