C29H37NO4 — CID 139718167
3-butoxy-1-butyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one (PubChem CID 139718167) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is 3-butoxy-1-butyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one.
| Compound Name | 3-butoxy-1-butyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718167 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 3-butoxy-1-butyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxyquinolin-2-one |
| SMILES | CCCCOc1c(OCC=C(C)C)c2ccc(OCc3ccccc3)cc2n(CCCC)c1=O |
| InChI | InChI=1S/C29H37NO4/c1-5-7-17-30-26-20-24(34-21-23-12-10-9-11-13-23)14-15-25(26)27(33-19-16-22(3)4)28(29(30)31)32-18-8-6-2/h9-16,20H,5-8,17-19,21H2,1-4H3 |
| InChIKey | KKEIBVAWPLZVBZ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|