C28H33NO4 — CID 139718204
1-butyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxy-3-prop-2-enoxyquinolin-2-one (PubChem CID 139718204) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-butyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxy-3-prop-2-enoxyquinolin-2-one.
| Compound Name | 1-butyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxy-3-prop-2-enoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718204 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 1-butyl-4-(3-methylbut-2-enoxy)-7-phenylmethoxy-3-prop-2-enoxyquinolin-2-one |
| SMILES | C=CCOc1c(OCC=C(C)C)c2ccc(OCc3ccccc3)cc2n(CCCC)c1=O |
| InChI | InChI=1S/C28H33NO4/c1-5-7-16-29-25-19-23(33-20-22-11-9-8-10-12-22)13-14-24(25)26(32-18-15-21(3)4)27(28(29)30)31-17-6-2/h6,8-15,19H,2,5,7,16-18,20H2,1,3-4H3 |
| InChIKey | HRMFIEJKSSBGQK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|