C26H32N2O4 — CID 23300520
N-(1-butyl-4-hexoxy-3-hydroxy-2-oxoquinolin-7-yl)benzamide (PubChem CID 23300520) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is N-(1-butyl-4-hexoxy-3-hydroxy-2-oxoquinolin-7-yl)benzamide.
| Compound Name | N-(1-butyl-4-hexoxy-3-hydroxy-2-oxoquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 23300520 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-(1-butyl-4-hexoxy-3-hydroxy-2-oxoquinolin-7-yl)benzamide |
| SMILES | CCCCCCOc1c(O)c(=O)n(CCCC)c2cc(NC(=O)c3ccccc3)ccc12 |
| InChI | InChI=1S/C26H32N2O4/c1-3-5-7-11-17-32-24-21-15-14-20(27-25(30)19-12-9-8-10-13-19)18-22(21)28(16-6-4-2)26(31)23(24)29/h8-10,12-15,18,29H,3-7,11,16-17H2,1-2H3,(H,27,30) |
| InChIKey | JOEBTKQQRQAMOB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|