C21H31NO4 — CID 139717591
1-butyl-4,7-dihydroxy-3-octoxyquinolin-2-one (PubChem CID 139717591) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 1-butyl-4,7-dihydroxy-3-octoxyquinolin-2-one.
| Compound Name | 1-butyl-4,7-dihydroxy-3-octoxyquinolin-2-one |
|---|---|
| PubChem CID | 139717591 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 1-butyl-4,7-dihydroxy-3-octoxyquinolin-2-one |
| SMILES | CCCCCCCCOc1c(O)c2ccc(O)cc2n(CCCC)c1=O |
| InChI | InChI=1S/C21H31NO4/c1-3-5-7-8-9-10-14-26-20-19(24)17-12-11-16(23)15-18(17)22(21(20)25)13-6-4-2/h11-12,15,23-24H,3-10,13-14H2,1-2H3 |
| InChIKey | LNIDKOYHULUTPM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|