C25H39NO4 — CID 139718130
3,4-dihydroxy-7-octoxy-1-octylquinolin-2-one (PubChem CID 139718130) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is 3,4-dihydroxy-7-octoxy-1-octylquinolin-2-one.
| Compound Name | 3,4-dihydroxy-7-octoxy-1-octylquinolin-2-one |
|---|---|
| PubChem CID | 139718130 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | 3,4-dihydroxy-7-octoxy-1-octylquinolin-2-one |
| SMILES | CCCCCCCCOc1ccc2c(O)c(O)c(=O)n(CCCCCCCC)c2c1 |
| InChI | InChI=1S/C25H39NO4/c1-3-5-7-9-11-13-17-26-22-19-20(30-18-14-12-10-8-6-4-2)15-16-21(22)23(27)24(28)25(26)29/h15-16,19,27-28H,3-14,17-18H2,1-2H3 |
| InChIKey | OXMHUYHRMPTSRZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|