C23H35NO4 — CID 139718059
1-hexyl-3,4-dihydroxy-7-octoxyquinolin-2-one (PubChem CID 139718059) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-hexyl-3,4-dihydroxy-7-octoxyquinolin-2-one.
| Compound Name | 1-hexyl-3,4-dihydroxy-7-octoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718059 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 1-hexyl-3,4-dihydroxy-7-octoxyquinolin-2-one |
| SMILES | CCCCCCCCOc1ccc2c(O)c(O)c(=O)n(CCCCCC)c2c1 |
| InChI | InChI=1S/C23H35NO4/c1-3-5-7-9-10-12-16-28-18-13-14-19-20(17-18)24(15-11-8-6-4-2)23(27)22(26)21(19)25/h13-14,17,25-26H,3-12,15-16H2,1-2H3 |
| InChIKey | CTRQNRBCQIJGNO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|